Products 61355-92-8
CAS 61355-92-8 is the registry number for Disperse Red 278. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 3-[3-acetamido-N-(3-methoxy-3-oxopropyl)-4-[(4-nitrophenyl)diazenyl]anilino]propanoate (CAS 61355-92-8) is a chemical compound with the molecular formula C22H25N5O7 and a molecular weight of 471.5 g/mol. IUPAC name: methyl 3-[3-acetamido-N-(3-methoxy-3-oxopropyl)-4-[(4-nitrophenyl)diazenyl]anilino]propanoate. InChIKey: BYMNHMLASYXHRV-UHFFFAOYSA-N.
| Molecular formula | C22H25N5O7 |
|---|---|
| Molecular weight | 471.5 g/mol |
| IUPAC name | methyl 3-[3-acetamido-N-(3-methoxy-3-oxopropyl)-4-[(4-nitrophenyl)diazenyl]anilino]propanoate |
| InChIKey | BYMNHMLASYXHRV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)N(CCC(=O)OC)CCC(=O)OC)N=NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)