Products 61357-75-3
CAS 61357-75-3 is the registry number for N-(4-bromo-2,3,5,6-tetradeuterio-phenyl)acetamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
N-(4-bromo-2,3,5,6-tetradeuteriophenyl)acetamide (CAS 61357-75-3) is a chemical compound with the molecular formula C8H8BrNO and a molecular weight of 218.08 g/mol. IUPAC name: N-(4-bromo-2,3,5,6-tetradeuteriophenyl)acetamide. InChIKey: MSLICLMCQYQNPK-QFFDRWTDSA-N.
| Molecular formula | C8H8BrNO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | N-(4-bromo-2,3,5,6-tetradeuteriophenyl)acetamide |
| InChIKey | MSLICLMCQYQNPK-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC(=O)C)[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)