CAS 61358-19-8 is the registry number for Bis(2,2,6,6-tetramethylpiperidin-4-yl) carbonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(2,2,6,6-tetramethylpiperidin-4-yl) carbonate (CAS 61358-19-8) is a chemical compound with the molecular formula C19H36N2O3 and a molecular weight of 340.5 g/mol. IUPAC name: bis(2,2,6,6-tetramethylpiperidin-4-yl) carbonate. InChIKey: VOTNCDKSGGSYMC-UHFFFAOYSA-N.
| Molecular formula | C19H36N2O3 |
|---|---|
| Molecular weight | 340.5 g/mol |
| IUPAC name | bis(2,2,6,6-tetramethylpiperidin-4-yl) carbonate |
| InChIKey | VOTNCDKSGGSYMC-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)OC(=O)OC2CC(NC(C2)(C)C)(C)C)C |
Computed by PubChem (NCBI)