CAS 61364-25-8 is the registry number for 2,5-Dimethyl-1h-indole-3-carbaldehyde, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g.
2,5-dimethyl-1H-indole-3-carbaldehyde (CAS 61364-25-8) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 2,5-dimethyl-1H-indole-3-carbaldehyde. InChIKey: XZAZUQNNIBOTFY-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2,5-dimethyl-1H-indole-3-carbaldehyde |
| InChIKey | XZAZUQNNIBOTFY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=C2C=O)C |
Computed by PubChem (NCBI)