CAS 61380-41-4 appears in our catalog under these names: Lofentanil Oxalate (1.0mg/ml in Acetonitrile), Lofentanil Oxalate. Offered by: TRC. Available pack sizes: 1x1ml, 10mg, 1mg.
Methyl (3S,4R)-3-methyl-1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate;oxalic acid (CAS 61380-41-4) is a chemical compound with the molecular formula C27H34N2O7 and a molecular weight of 498.6 g/mol. IUPAC name: methyl (3S,4R)-3-methyl-1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate;oxalic acid. InChIKey: CBKLICUQYUTWQL-XWGBWKJCSA-N.
| Molecular formula | C27H34N2O7 |
|---|---|
| Molecular weight | 498.6 g/mol |
| IUPAC name | methyl (3S,4R)-3-methyl-1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate;oxalic acid |
| InChIKey | CBKLICUQYUTWQL-XWGBWKJCSA-N |
| SMILES | CCC(=O)N(C1=CC=CC=C1)[C@@]2(CCN(C[C@@H]2C)CCC3=CC=CC=C3)C(=O)OC.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)