Products 614-17-5

CAS 614-17-5 is the registry number for N-Ethylbenzamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

N-ethylbenzamide (CAS 614-17-5) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: N-ethylbenzamide. InChIKey: SDIDYFBTIZOPLA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO
Molecular weight149.19 g/mol
IUPAC nameN-ethylbenzamide
InChIKeySDIDYFBTIZOPLA-UHFFFAOYSA-N
SMILESCCNC(=O)C1=CC=CC=C1

Computed by PubChem (NCBI)