CAS 614-39-1 appears in our catalog under these names: Procainamide hydrochloride, 95%, Procainamide HCl, Procainamide Hydrochloride, >95% (HPLC), Procainamide Hydrochloride, Procainamide hydrochloride/ 100%. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Dr. Ehrenstorfer. Available pack sizes: 100g, 25g, 500g, 5g, on request, 500mg, 250mg, 50mg.
4-amino-N-[2-(diethylamino)ethyl]benzamide;hydrochloride (CAS 614-39-1) is a chemical compound with the molecular formula C13H22ClN3O and a molecular weight of 271.78 g/mol. IUPAC name: 4-amino-N-[2-(diethylamino)ethyl]benzamide;hydrochloride. InChIKey: ABTXGJFUQRCPNH-UHFFFAOYSA-N.
| Molecular formula | C13H22ClN3O |
|---|---|
| Molecular weight | 271.78 g/mol |
| IUPAC name | 4-amino-N-[2-(diethylamino)ethyl]benzamide;hydrochloride |
| InChIKey | ABTXGJFUQRCPNH-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)C1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)