CAS 61438-64-0 appears in our catalog under these names: Closantel Sodium Salt, >95% (HPLC), Closantel Sodium/ 100%, Closantel Sodium, Closantel sodium dihydrate, Closantel sodium 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 1g, 5g, 500mg, 10mM (in 1ml dmso), 50mg, 250mg, 25g.
Sodium 2-[[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]carbamoyl]-4,6-diiodophenolate (CAS 61438-64-0) is a chemical compound with the molecular formula C22H13Cl2I2N2NaO2 and a molecular weight of 685.1 g/mol. IUPAC name: sodium 2-[[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]carbamoyl]-4,6-diiodophenolate. InChIKey: LREGMDNUOGTSIK-UHFFFAOYSA-M.
| Molecular formula | C22H13Cl2I2N2NaO2 |
|---|---|
| Molecular weight | 685.1 g/mol |
| IUPAC name | sodium 2-[[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]carbamoyl]-4,6-diiodophenolate |
| InChIKey | LREGMDNUOGTSIK-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C=C1NC(=O)C2=C(C(=CC(=C2)I)I)[O-])Cl)C(C#N)C3=CC=C(C=C3)Cl.[Na+] |
Computed by PubChem (NCBI)