CAS 61452-85-5 is the registry number for 2,4-Dichloro-6-(3-chlorophenyl)-1,3,5-triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-6-(3-chlorophenyl)-1,3,5-triazine (CAS 61452-85-5) is a chemical compound with the molecular formula C9H4Cl3N3 and a molecular weight of 260.5 g/mol. IUPAC name: 2,4-dichloro-6-(3-chlorophenyl)-1,3,5-triazine. InChIKey: RDUSVERJOHRVGE-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3N3 |
|---|---|
| Molecular weight | 260.5 g/mol |
| IUPAC name | 2,4-dichloro-6-(3-chlorophenyl)-1,3,5-triazine |
| InChIKey | RDUSVERJOHRVGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)