Products 61466-95-3
CAS 61466-95-3 appears in our catalog under these names: a-Hydroxy Flurbiprofen, >95% (HPLC), alpha-Hydroxy Flurbiprofen, >95% (HPLC), Flurbiprofen EP Impurity C, Flurbiprofen Impurity C, (2RS)-2-(2-Fluorobiphenyl-4-yl)-2-hydroxypropanoic Acid. Offered by: TRC, Chemat Brand, Mikromol, GLPBio, Biosynth. Available pack sizes: 2,5g, 250mg, on request, 50mg, 1g, 5000mg, 1000mg, 100mg.
2-(3-fluoro-4-phenylphenyl)-2-hydroxypropanoic acid (CAS 61466-95-3) is a chemical compound with the molecular formula C15H13FO3 and a molecular weight of 260.26 g/mol. IUPAC name: 2-(3-fluoro-4-phenylphenyl)-2-hydroxypropanoic acid. InChIKey: WZESXUMKHKBMLE-UHFFFAOYSA-N.
| Molecular formula | C15H13FO3 |
|---|---|
| Molecular weight | 260.26 g/mol |
| IUPAC name | 2-(3-fluoro-4-phenylphenyl)-2-hydroxypropanoic acid |
| InChIKey | WZESXUMKHKBMLE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(2-Fluorobiphenyl-4-yl)-2-hydroxypropanoic acid, (2RS)-2-(2-Fluorobiphenyl-4-yl)-2-hydroxypropanoic Acid, FLURBIPROFEN IMPURITY C [EP IMPURITY], FLURBIPROFEN IMPURITY C (EP IMPURITY), alpha-Hydroxy Flurbiprofen, 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)-2-hydroxypropanoic acid, Flurbiprofen EP Impurity C, a-Hydroxy Flurbiprofen, 2-{2-fluoro-[1,1'-biphenyl]-4-yl}-2-hydroxypropanoic acid, 2-(3-fluoro-4-phenylphenyl)-2-hydroxypropanoic acid