CAS 61499-34-1 is the registry number for 2-((2,3,4,5,6-pentafluorophenyl)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(2,3,4,5,6-pentafluorophenyl)methylidene]indene-1,3-dione (CAS 61499-34-1) is a chemical compound with the molecular formula C16H5F5O2 and a molecular weight of 324.20 g/mol. IUPAC name: 2-[(2,3,4,5,6-pentafluorophenyl)methylidene]indene-1,3-dione. InChIKey: OKPFKBKIZVGIHM-UHFFFAOYSA-N.
| Molecular formula | C16H5F5O2 |
|---|---|
| Molecular weight | 324.20 g/mol |
| IUPAC name | 2-[(2,3,4,5,6-pentafluorophenyl)methylidene]indene-1,3-dione |
| InChIKey | OKPFKBKIZVGIHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CC3=C(C(=C(C(=C3F)F)F)F)F)C2=O |
Computed by PubChem (NCBI)