CAS 615254-93-8 is the registry number for (R)-Tolterodine Fumarate. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-but-2-enedioic acid;2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenol (CAS 615254-93-8) is a chemical compound with the molecular formula C26H35NO5 and a molecular weight of 441.6 g/mol. IUPAC name: (E)-but-2-enedioic acid;2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenol. InChIKey: HKTZTYRSKPLEIQ-BOQYJDHWSA-N.
| Molecular formula | C26H35NO5 |
|---|---|
| Molecular weight | 441.6 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenol |
| InChIKey | HKTZTYRSKPLEIQ-BOQYJDHWSA-N |
| SMILES | CC1=CC(=C(C=C1)O)[C@H](CCN(C(C)C)C(C)C)C2=CC=CC=C2.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)