CAS 615263-37-1 is the registry number for Fluvastatin Ethyl Ester. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
Ethyl (E,3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate (CAS 615263-37-1) is a chemical compound with the molecular formula C26H30FNO4 and a molecular weight of 439.5 g/mol. IUPAC name: ethyl (E,3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate. InChIKey: QHZGLNLLTBLIDC-UQFLNUTESA-N.
| Molecular formula | C26H30FNO4 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | ethyl (E,3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate |
| InChIKey | QHZGLNLLTBLIDC-UQFLNUTESA-N |
| SMILES | CCOC(=O)C[C@H](C[C@H](/C=C/C1=C(C2=CC=CC=C2N1C(C)C)C3=CC=C(C=C3)F)O)O |
Computed by PubChem (NCBI)