CAS 615263-39-3 is the registry number for Fluvastatin Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.
Propan-2-yl (E,3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate (CAS 615263-39-3) is a chemical compound with the molecular formula C27H32FNO4 and a molecular weight of 453.5 g/mol. IUPAC name: propan-2-yl (E,3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate. InChIKey: QXMWVLOVEHOMGZ-WRBWEIJPSA-N.
| Molecular formula | C27H32FNO4 |
|---|---|
| Molecular weight | 453.5 g/mol |
| IUPAC name | propan-2-yl (E,3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate |
| InChIKey | QXMWVLOVEHOMGZ-WRBWEIJPSA-N |
| SMILES | CC(C)N1C2=CC=CC=C2C(=C1/C=C/[C@H](C[C@H](CC(=O)OC(C)C)O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)