CAS 61539-61-5 is the registry number for 1,1-Dimethoxy-3-(trimethylsiloxy)-1,3-butadiene. Offered by: TRC. Available pack sizes: 5g.
4,4-dimethoxybuta-1,3-dien-2-yloxy(trimethyl)silane (CAS 61539-61-5) is a chemical compound with the molecular formula C9H18O3Si and a molecular weight of 202.32 g/mol. IUPAC name: 4,4-dimethoxybuta-1,3-dien-2-yloxy(trimethyl)silane. InChIKey: NNEOHWMKADOBOT-UHFFFAOYSA-N.
| Molecular formula | C9H18O3Si |
|---|---|
| Molecular weight | 202.32 g/mol |
| IUPAC name | 4,4-dimethoxybuta-1,3-dien-2-yloxy(trimethyl)silane |
| InChIKey | NNEOHWMKADOBOT-UHFFFAOYSA-N |
| SMILES | COC(=CC(=C)O[Si](C)(C)C)OC |
Computed by PubChem (NCBI)