CAS 615556-29-1 is the registry number for (2R,3S)-N-(2-Nitrobenzenesulfenyl)-3-phenylisoserine Methyl Ester. Offered by: TRC. Available pack sizes: 1g.
Methyl 2-hydroxy-3-[(2-nitrophenyl)sulfanylamino]-3-phenylpropanoate (CAS 615556-29-1) is a chemical compound with the molecular formula C16H16N2O5S and a molecular weight of 348.4 g/mol. IUPAC name: methyl 2-hydroxy-3-[(2-nitrophenyl)sulfanylamino]-3-phenylpropanoate. InChIKey: CVWNACXTMHQGJE-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O5S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | methyl 2-hydroxy-3-[(2-nitrophenyl)sulfanylamino]-3-phenylpropanoate |
| InChIKey | CVWNACXTMHQGJE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C1=CC=CC=C1)NSC2=CC=CC=C2[N+](=O)[O-])O |
Computed by PubChem (NCBI)