Products 65019-55-8

CAS 65019-55-8 is the registry number for 4-((4-Acetamidophenylsulfonamido)methyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

4-[[(4-acetamidophenyl)sulfonylamino]methyl]benzoic acid (CAS 65019-55-8) is a chemical compound with the molecular formula C16H16N2O5S and a molecular weight of 348.4 g/mol. IUPAC name: 4-[[(4-acetamidophenyl)sulfonylamino]methyl]benzoic acid. InChIKey: HZDGWUPMRIQILX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16N2O5S
Molecular weight348.4 g/mol
IUPAC name4-[[(4-acetamidophenyl)sulfonylamino]methyl]benzoic acid
InChIKeyHZDGWUPMRIQILX-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC=C(C=C1)S(=O)(=O)NCC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)