CAS 615571-23-8 appears in our catalog under these names: SSR504734, 98%, SSR504734 HCl/ 98.14% (existing batch purity), SSR504734, SSR 504734 hydrochloride, 2-Chloro-N-((S)-phenyl((S)-piperidin-2-yl)methyl)-3-(trifluoromethyl)benzamide hydrochloride. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 50 mg.
2-chloro-N-[(S)-phenyl-[(2S)-piperidin-2-yl]methyl]-3-(trifluoromethyl)benzamide (CAS 615571-23-8) is a chemical compound with the molecular formula C20H20ClF3N2O and a molecular weight of 396.8 g/mol. IUPAC name: 2-chloro-N-[(S)-phenyl-[(2S)-piperidin-2-yl]methyl]-3-(trifluoromethyl)benzamide. InChIKey: MEZRZVWPLXVLSO-WMZOPIPTSA-N.
| Molecular formula | C20H20ClF3N2O |
|---|---|
| Molecular weight | 396.8 g/mol |
| IUPAC name | 2-chloro-N-[(S)-phenyl-[(2S)-piperidin-2-yl]methyl]-3-(trifluoromethyl)benzamide |
| InChIKey | MEZRZVWPLXVLSO-WMZOPIPTSA-N |
| SMILES | C1CCN[C@@H](C1)[C@H](C2=CC=CC=C2)NC(=O)C3=C(C(=CC=C3)C(F)(F)F)Cl |
Computed by PubChem (NCBI)