CAS 61583-29-7 is the registry number for Dichloro(2,3-naphthalenediamine-N,N')platinum, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Dichloroplatinum;naphthalene-2,3-diamine (CAS 61583-29-7) is a chemical compound with the molecular formula C10H10Cl2N2Pt and a molecular weight of 424.2 g/mol. IUPAC name: dichloroplatinum;naphthalene-2,3-diamine. InChIKey: NDXSQMUKHPCUBU-UHFFFAOYSA-L.
| Molecular formula | C10H10Cl2N2Pt |
|---|---|
| Molecular weight | 424.2 g/mol |
| IUPAC name | dichloroplatinum;naphthalene-2,3-diamine |
| InChIKey | NDXSQMUKHPCUBU-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)N)N.Cl[Pt]Cl |
Computed by PubChem (NCBI)