CAS 61586-78-5 is the registry number for (1R,2S)-Cis-2-hydroxycyclohexane-carboxylic acid ethylester. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-ethyl (1R,2S)-2-hydroxycyclohexane-1-carboxylate (CAS 61586-78-5) is a chemical compound with the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. IUPAC name: cis-ethyl (1R,2S)-2-hydroxycyclohexane-1-carboxylate. InChIKey: WOGRTPJVNNCUKN-SFYZADRCSA-N.
| Molecular formula | C9H16O3 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | cis-ethyl (1R,2S)-2-hydroxycyclohexane-1-carboxylate |
| InChIKey | WOGRTPJVNNCUKN-SFYZADRCSA-N |
| SMILES | CCOC(=O)[C@@H]1CCCC[C@@H]1O |
Computed by PubChem (NCBI)