Products 6159-48-4
CAS 6159-48-4 is the registry number for 3-(1H-Imidazol-4-yl)prop-2-enoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
(E)-3-(1H-imidazol-5-yl)prop-2-enoic acid;hydrochloride (CAS 6159-48-4) is a chemical compound with the molecular formula C6H7ClN2O2 and a molecular weight of 174.58 g/mol. IUPAC name: (E)-3-(1H-imidazol-5-yl)prop-2-enoic acid;hydrochloride. InChIKey: HIHJZBXMBVLFJY-TYYBGVCCSA-N.
| Molecular formula | C6H7ClN2O2 |
|---|---|
| Molecular weight | 174.58 g/mol |
| IUPAC name | (E)-3-(1H-imidazol-5-yl)prop-2-enoic acid;hydrochloride |
| InChIKey | HIHJZBXMBVLFJY-TYYBGVCCSA-N |
| SMILES | C1=C(NC=N1)/C=C/C(=O)O.Cl |
Computed by PubChem (NCBI)