CAS 61607-83-8 is the registry number for Cupric Nonylphenolsulfonate. Offered by: TRC. Available pack sizes: 50mg.
Copper;bis(4-nonyl-2-sulfophenolate) (CAS 61607-83-8) is a chemical compound with the molecular formula C30H46CuO8S2-2 and a molecular weight of 662.4 g/mol. IUPAC name: copper;bis(4-nonyl-2-sulfophenolate). InChIKey: ADNNXYUTZBSYEP-UHFFFAOYSA-L.
| Molecular formula | C30H46CuO8S2-2 |
|---|---|
| Molecular weight | 662.4 g/mol |
| IUPAC name | copper;bis(4-nonyl-2-sulfophenolate) |
| InChIKey | ADNNXYUTZBSYEP-UHFFFAOYSA-L |
| SMILES | CCCCCCCCCC1=CC(=C(C=C1)[O-])S(=O)(=O)O.CCCCCCCCCC1=CC(=C(C=C1)[O-])S(=O)(=O)O.[Cu] |
Computed by PubChem (NCBI)