CAS 61617-00-3 is the registry number for 4,(5)-Methyl Mercapto Benzimidazole Zinc Salt. Offered by: TRC. Available pack sizes: 10g, 1g, 5g.
Zinc bis(4-methyl-1H-benzimidazole-2-thiolate) (CAS 61617-00-3) is a chemical compound with the molecular formula C16H14N4S2Zn and a molecular weight of 391.8 g/mol. IUPAC name: zinc bis(4-methyl-1H-benzimidazole-2-thiolate). InChIKey: GHPJYLIEFFVDGR-UHFFFAOYSA-L.
| Molecular formula | C16H14N4S2Zn |
|---|---|
| Molecular weight | 391.8 g/mol |
| IUPAC name | zinc bis(4-methyl-1H-benzimidazole-2-thiolate) |
| InChIKey | GHPJYLIEFFVDGR-UHFFFAOYSA-L |
| SMILES | CC1=C2C(=CC=C1)NC(=N2)[S-].CC1=C2C(=CC=C1)NC(=N2)[S-].[Zn+2] |
Computed by PubChem (NCBI)