CAS 61658-90-0 appears in our catalog under these names: Butylphthalide Impurity 22, Butylphthalide Impurity 9. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3E)-3-ethylidene-2-benzofuran-1-one (CAS 61658-90-0) is a chemical compound with the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. IUPAC name: (3E)-3-ethylidene-2-benzofuran-1-one. InChIKey: FLOWXWKOKRXGBR-XNWCZRBMSA-N.
| Molecular formula | C10H8O2 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | (3E)-3-ethylidene-2-benzofuran-1-one |
| InChIKey | FLOWXWKOKRXGBR-XNWCZRBMSA-N |
| SMILES | C/C=C/1\C2=CC=CC=C2C(=O)O1 |
Computed by PubChem (NCBI)