CAS 6168-88-3 appears in our catalog under these names: Lobelanine hydrochloride, 95%, Lobelanine Hydrochloride, Rel-2,2'-((2S,6R)-1-Methylpiperidine-2,6-diyl)bis(1-phenylethanone) hydrochloride, 98%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 10mg, 25mg, 50mg.
2-[(2R,6S)-1-methyl-6-phenacylpiperidin-2-yl]-1-phenylethanone;hydrochloride (CAS 6168-88-3) is a chemical compound with the molecular formula C22H26ClNO2 and a molecular weight of 371.9 g/mol. IUPAC name: 2-[(2R,6S)-1-methyl-6-phenacylpiperidin-2-yl]-1-phenylethanone;hydrochloride. InChIKey: TVXBKVYKFXLEAI-AMDBCLDASA-N.
| Molecular formula | C22H26ClNO2 |
|---|---|
| Molecular weight | 371.9 g/mol |
| IUPAC name | 2-[(2R,6S)-1-methyl-6-phenacylpiperidin-2-yl]-1-phenylethanone;hydrochloride |
| InChIKey | TVXBKVYKFXLEAI-AMDBCLDASA-N |
| SMILES | CN1[C@H](CCC[C@H]1CC(=O)C2=CC=CC=C2)CC(=O)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)