CAS 6170-42-9 appears in our catalog under these names: Chloropyramine Hydrochloride, >95% (HPLC), Chloropyramine Hydrochloride, Chloropyramine hydrochloride/ 99.58% (existing batch purity), Chloropyramine hydrochloride, Chloropyramine hydrochloride . Offered by: TRC, Mikromol, LoGiCal, TargetMol, GLPBio. Available pack sizes: 1g, 500mg, 250mg, 10mg, 25mg, 50mg, 100mg, 200mg.
N'-[(4-chlorophenyl)methyl]-N,N-dimethyl-N'-pyridin-2-ylethane-1,2-diamine;hydrochloride (CAS 6170-42-9) is a chemical compound with the molecular formula C16H21Cl2N3 and a molecular weight of 326.3 g/mol. IUPAC name: N'-[(4-chlorophenyl)methyl]-N,N-dimethyl-N'-pyridin-2-ylethane-1,2-diamine;hydrochloride. InChIKey: VEYWWAGBHABATA-UHFFFAOYSA-N.
| Molecular formula | C16H21Cl2N3 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | N'-[(4-chlorophenyl)methyl]-N,N-dimethyl-N'-pyridin-2-ylethane-1,2-diamine;hydrochloride |
| InChIKey | VEYWWAGBHABATA-UHFFFAOYSA-N |
| SMILES | CN(C)CCN(CC1=CC=C(C=C1)Cl)C2=CC=CC=N2.Cl |
Computed by PubChem (NCBI)