CAS 61709-33-9 appears in our catalog under these names: Tioconazole Related Compound A, 2-Deschlorothien-3-yl Tioconazole Hydrochloride, 1-((2RS)-2-(2,4-Dichlorophenyl)-2-((thiophen-3-yl)methoxy)ethyl)-1H-imidazole Hydrochloride. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 25mg, 100mg.
1-[2-(2,4-dichlorophenyl)-2-(thiophen-3-ylmethoxy)ethyl]imidazole;hydrochloride (CAS 61709-33-9) is a chemical compound with the molecular formula C16H15Cl3N2OS and a molecular weight of 389.7 g/mol. IUPAC name: 1-[2-(2,4-dichlorophenyl)-2-(thiophen-3-ylmethoxy)ethyl]imidazole;hydrochloride. InChIKey: CCCQSJHDZKYQKU-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl3N2OS |
|---|---|
| Molecular weight | 389.7 g/mol |
| IUPAC name | 1-[2-(2,4-dichlorophenyl)-2-(thiophen-3-ylmethoxy)ethyl]imidazole;hydrochloride |
| InChIKey | CCCQSJHDZKYQKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(CN2C=CN=C2)OCC3=CSC=C3.Cl |
Computed by PubChem (NCBI)