Products 617690-26-3

CAS 617690-26-3 appears in our catalog under these names: Cis-2-methyloxolane-3-carboxylic acid, 95%, rac-(2R,3R)-2-Methyloxolane-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

(2S,3S)-2-methyloxolane-3-carboxylic acid (CAS 617690-26-3) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. IUPAC name: (2S,3S)-2-methyloxolane-3-carboxylic acid. InChIKey: YXVATTQXDIZNEP-WHFBIAKZSA-N.

Identity
Molecular formulaC6H10O3
Molecular weight130.14 g/mol
IUPAC name(2S,3S)-2-methyloxolane-3-carboxylic acid
InChIKeyYXVATTQXDIZNEP-WHFBIAKZSA-N
SMILESC[C@H]1[C@H](CCO1)C(=O)O

Computed by PubChem (NCBI)