CAS 617706-20-4 is the registry number for Methyl 5-bromo-3-(trifluoromethyl)benzo[b]thiophene-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 5-bromo-3-(trifluoromethyl)-1-benzothiophene-2-carboxylate (CAS 617706-20-4) is a chemical compound with the molecular formula C11H6BrF3O2S and a molecular weight of 339.13 g/mol. IUPAC name: methyl 5-bromo-3-(trifluoromethyl)-1-benzothiophene-2-carboxylate. InChIKey: ZINISNQPSKGMKN-UHFFFAOYSA-N.
| Molecular formula | C11H6BrF3O2S |
|---|---|
| Molecular weight | 339.13 g/mol |
| IUPAC name | methyl 5-bromo-3-(trifluoromethyl)-1-benzothiophene-2-carboxylate |
| InChIKey | ZINISNQPSKGMKN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)C=CC(=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)