Products 617710-53-9
CAS 617710-53-9 appears in our catalog under these names: (1R)-1-(3,5-Dichlorophenyl)ethylamine, 95%, (R)–1–(3，5–Dichlorophenyl)ethanamine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
(1R)-1-(3,5-dichlorophenyl)ethanamine (CAS 617710-53-9) is a chemical compound with the molecular formula C8H9Cl2N and a molecular weight of 190.07 g/mol. IUPAC name: (1R)-1-(3,5-dichlorophenyl)ethanamine. InChIKey: DYNJVRIGZRAWQN-RXMQYKEDSA-N.
| Molecular formula | C8H9Cl2N |
|---|---|
| Molecular weight | 190.07 g/mol |
| IUPAC name | (1R)-1-(3,5-dichlorophenyl)ethanamine |
| InChIKey | DYNJVRIGZRAWQN-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)Cl)Cl)N |
Computed by PubChem (NCBI)