CAS 617714-54-2 is the registry number for tert-Butyl rel-(1S,4S,5R)-5-hydroxy-2-azabicyclo(2.2.2)octane-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (1R,4R,5S)-5-hydroxy-2-azabicyclo[2.2.2]octane-2-carboxylate (CAS 617714-54-2) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl (1R,4R,5S)-5-hydroxy-2-azabicyclo[2.2.2]octane-2-carboxylate. InChIKey: FNZOIHBLVUIGLG-BBBLOLIVSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl (1R,4R,5S)-5-hydroxy-2-azabicyclo[2.2.2]octane-2-carboxylate |
| InChIKey | FNZOIHBLVUIGLG-BBBLOLIVSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC[C@@H]1C[C@@H]2O |
Computed by PubChem (NCBI)