CAS 618-21-3 appears in our catalog under these names: 4-Phosphonobenzoic acid, 95%, 4–Phosphonobenzoic acid, 4-Phosphonobenzoic Acid, >96.0%(HPLC)(T), 4-Phosphonobenzoic acid 95+%, 4-Phosphonobenzoic Acid, 95+%, 95+%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 200mg, 100mg, 250mg, 1g.
4-phosphonobenzoic acid (CAS 618-21-3) is a chemical compound with the molecular formula C7H7O5P and a molecular weight of 202.10 g/mol. IUPAC name: 4-phosphonobenzoic acid. InChIKey: IEQICHVXWFGDAN-UHFFFAOYSA-N.
| Molecular formula | C7H7O5P |
|---|---|
| Molecular weight | 202.10 g/mol |
| IUPAC name | 4-phosphonobenzoic acid |
| InChIKey | IEQICHVXWFGDAN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)P(=O)(O)O |
Computed by PubChem (NCBI)