CAS 618-64-4 is the registry number for 3-Amino-5-nitrophenol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-amino-5-nitrophenol (CAS 618-64-4) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 3-amino-5-nitrophenol. InChIKey: VYBFQVODGUQVGO-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | 3-amino-5-nitrophenol |
| InChIKey | VYBFQVODGUQVGO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])O)N |
Computed by PubChem (NCBI)