Products 618068-98-7
CAS 618068-98-7 is the registry number for OSU-02067. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[5-phenanthren-2-yl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (CAS 618068-98-7) is a chemical compound with the molecular formula C24H16F3N3O2S and a molecular weight of 467.5 g/mol. IUPAC name: 4-[5-phenanthren-2-yl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide. InChIKey: HNXYHZZMVJBSRC-UHFFFAOYSA-N.
| Molecular formula | C24H16F3N3O2S |
|---|---|
| Molecular weight | 467.5 g/mol |
| IUPAC name | 4-[5-phenanthren-2-yl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| InChIKey | HNXYHZZMVJBSRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC(=C3)C4=CC(=NN4C5=CC=C(C=C5)S(=O)(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)