Products 618070-55-6

CAS 618070-55-6 is the registry number for Ethyl 1-(4-fluorobenzyl)-3-phenyl-1H-pyrazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.

Structural formula: {0} (CAS {1})

Ethyl 1-[(4-fluorophenyl)methyl]-3-phenylpyrazole-5-carboxylate (CAS 618070-55-6) is a chemical compound with the molecular formula C19H17FN2O2 and a molecular weight of 324.3 g/mol. IUPAC name: ethyl 1-[(4-fluorophenyl)methyl]-3-phenylpyrazole-5-carboxylate. InChIKey: KIYLSXORQGQIGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H17FN2O2
Molecular weight324.3 g/mol
IUPAC nameethyl 1-[(4-fluorophenyl)methyl]-3-phenylpyrazole-5-carboxylate
InChIKeyKIYLSXORQGQIGJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=NN1CC2=CC=C(C=C2)F)C3=CC=CC=C3

Computed by PubChem (NCBI)