CAS 618070-63-6 appears in our catalog under these names: 1-(4-Bromophenyl)-5-(trifluoromethyl)-1h-pyrazole-4-carboxylic acid, 95%, 1-(4-Bromophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 95+%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
1-(4-bromophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 618070-63-6) is a chemical compound with the molecular formula C11H6BrF3N2O2 and a molecular weight of 335.08 g/mol. IUPAC name: 1-(4-bromophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: PANAIRIJPGLPGO-UHFFFAOYSA-N.
| Molecular formula | C11H6BrF3N2O2 |
|---|---|
| Molecular weight | 335.08 g/mol |
| IUPAC name | 1-(4-bromophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | PANAIRIJPGLPGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=C(C=N2)C(=O)O)C(F)(F)F)Br |
Computed by PubChem (NCBI)