CAS 618091-38-6 is the registry number for (5-Amino-1-(4-fluorophenyl)-1H-pyrazol-4-yl)(4-chlorophenyl)methanone, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-amino-1-(4-fluorophenyl)pyrazol-4-yl]-(4-chlorophenyl)methanone (CAS 618091-38-6) is a chemical compound with the molecular formula C16H11ClFN3O and a molecular weight of 315.73 g/mol. IUPAC name: [5-amino-1-(4-fluorophenyl)pyrazol-4-yl]-(4-chlorophenyl)methanone. InChIKey: SPBJSPXXKFWOMN-UHFFFAOYSA-N.
| Molecular formula | C16H11ClFN3O |
|---|---|
| Molecular weight | 315.73 g/mol |
| IUPAC name | [5-amino-1-(4-fluorophenyl)pyrazol-4-yl]-(4-chlorophenyl)methanone |
| InChIKey | SPBJSPXXKFWOMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(N(N=C2)C3=CC=C(C=C3)F)N)Cl |
Computed by PubChem (NCBI)