CAS 618092-42-5 is the registry number for 1-(4-Chlorophenyl)-5-methyl-1H-pyrazole-4-carbohydrazide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 50mg, 250mg, 1g.
1-(4-chlorophenyl)-5-methylpyrazole-4-carbohydrazide (CAS 618092-42-5) is a chemical compound with the molecular formula C11H11ClN4O and a molecular weight of 250.68 g/mol. IUPAC name: 1-(4-chlorophenyl)-5-methylpyrazole-4-carbohydrazide. InChIKey: OWGYQSBCCPXQTF-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4O |
|---|---|
| Molecular weight | 250.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-5-methylpyrazole-4-carbohydrazide |
| InChIKey | OWGYQSBCCPXQTF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=CC=C(C=C2)Cl)C(=O)NN |
Computed by PubChem (NCBI)