Products 618098-45-6
CAS 618098-45-6 is the registry number for 3-(4-Fluorophenyl)-1-(4-methylphenyl)-1H-pyrazole-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(4-fluorophenyl)-1-(4-methylphenyl)pyrazole-4-carbaldehyde (CAS 618098-45-6) is a chemical compound with the molecular formula C17H13FN2O and a molecular weight of 280.30 g/mol. IUPAC name: 3-(4-fluorophenyl)-1-(4-methylphenyl)pyrazole-4-carbaldehyde. InChIKey: PHMDMVGDKSYMHR-UHFFFAOYSA-N.
| Molecular formula | C17H13FN2O |
|---|---|
| Molecular weight | 280.30 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-1-(4-methylphenyl)pyrazole-4-carbaldehyde |
| InChIKey | PHMDMVGDKSYMHR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C=C(C(=N2)C3=CC=C(C=C3)F)C=O |
Computed by PubChem (NCBI)