Products 618102-12-8

CAS 618102-12-8 is the registry number for 1-(4-Bromophenyl)-3-p-tolyl-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-(4-bromophenyl)-3-(4-methylphenyl)pyrazole-5-carboxylic acid (CAS 618102-12-8) is a chemical compound with the molecular formula C17H13BrN2O2 and a molecular weight of 357.2 g/mol. IUPAC name: 1-(4-bromophenyl)-3-(4-methylphenyl)pyrazole-5-carboxylic acid. InChIKey: PNEFLRLQDQRRGY-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13BrN2O2
Molecular weight357.2 g/mol
IUPAC name1-(4-bromophenyl)-3-(4-methylphenyl)pyrazole-5-carboxylic acid
InChIKeyPNEFLRLQDQRRGY-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=NN(C(=C2)C(=O)O)C3=CC=C(C=C3)Br

Computed by PubChem (NCBI)