CAS 618102-70-8 is the registry number for 3-(4-Bromophenyl)-1-(2,4-difluorophenyl)-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 10g, 25g.
3-(4-bromophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxylic acid (CAS 618102-70-8) is a chemical compound with the molecular formula C16H9BrF2N2O2 and a molecular weight of 379.15 g/mol. IUPAC name: 3-(4-bromophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxylic acid. InChIKey: WZONOAVSQSPEHA-UHFFFAOYSA-N.
| Molecular formula | C16H9BrF2N2O2 |
|---|---|
| Molecular weight | 379.15 g/mol |
| IUPAC name | 3-(4-bromophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxylic acid |
| InChIKey | WZONOAVSQSPEHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN(C(=C2)C(=O)O)C3=C(C=C(C=C3)F)F)Br |
Computed by PubChem (NCBI)