CAS 61826-32-2 is the registry number for Clemastine Impurity 3 Fumarate (S,R-isomer). Offered by: Chemat Brand. Available pack sizes: on request.
(E)-but-2-enedioic acid;(2S)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-1-methylpyrrolidine (CAS 61826-32-2) is a chemical compound with the molecular formula C25H30ClNO5 and a molecular weight of 460.0 g/mol. IUPAC name: (E)-but-2-enedioic acid;(2S)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-1-methylpyrrolidine. InChIKey: PMGQWSIVQFOFOQ-CDMZRFRJSA-N.
| Molecular formula | C25H30ClNO5 |
|---|---|
| Molecular weight | 460.0 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;(2S)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-1-methylpyrrolidine |
| InChIKey | PMGQWSIVQFOFOQ-CDMZRFRJSA-N |
| SMILES | C[C@@](C1=CC=CC=C1)(C2=CC=C(C=C2)Cl)OCC[C@@H]3CCCN3C.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)