Products 61834-24-0

CAS 61834-24-0 is the registry number for Methyl 4,5-dimethyl-2-furoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4,5-dimethylfuran-2-carboxylate (CAS 61834-24-0) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. IUPAC name: methyl 4,5-dimethylfuran-2-carboxylate. InChIKey: WJWPDGWSQADZFK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O3
Molecular weight154.16 g/mol
IUPAC namemethyl 4,5-dimethylfuran-2-carboxylate
InChIKeyWJWPDGWSQADZFK-UHFFFAOYSA-N
SMILESCC1=C(OC(=C1)C(=O)OC)C

Computed by PubChem (NCBI)