CAS 618382-90-4 is the registry number for 3-(2,4-Dichloro-5-fluorophenyl)-1-(m-tolyl)-1H-pyrazole-5-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,4-dichloro-5-fluorophenyl)-1-(3-methylphenyl)pyrazole-5-carboxylic acid (CAS 618382-90-4) is a chemical compound with the molecular formula C17H11Cl2FN2O2 and a molecular weight of 365.2 g/mol. IUPAC name: 3-(2,4-dichloro-5-fluorophenyl)-1-(3-methylphenyl)pyrazole-5-carboxylic acid. InChIKey: HEMGJEQMDBBDMT-UHFFFAOYSA-N.
| Molecular formula | C17H11Cl2FN2O2 |
|---|---|
| Molecular weight | 365.2 g/mol |
| IUPAC name | 3-(2,4-dichloro-5-fluorophenyl)-1-(3-methylphenyl)pyrazole-5-carboxylic acid |
| InChIKey | HEMGJEQMDBBDMT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=CC(=N2)C3=CC(=C(C=C3Cl)Cl)F)C(=O)O |
Computed by PubChem (NCBI)