CAS 61839-10-9 is the registry number for 5'-S-(1-Methylpropyl)-5'-thio-adenosine. Offered by: TRC. Available pack sizes: 100mg.
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(butan-2-ylsulfanylmethyl)oxolane-3,4-diol (CAS 61839-10-9) is a chemical compound with the molecular formula C14H21N5O3S and a molecular weight of 339.42 g/mol. IUPAC name: (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(butan-2-ylsulfanylmethyl)oxolane-3,4-diol. InChIKey: ZNFXDFISGWTKOH-HVMNINKTSA-N.
| Molecular formula | C14H21N5O3S |
|---|---|
| Molecular weight | 339.42 g/mol |
| IUPAC name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(butan-2-ylsulfanylmethyl)oxolane-3,4-diol |
| InChIKey | ZNFXDFISGWTKOH-HVMNINKTSA-N |
| SMILES | CCC(C)SC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)O |
Computed by PubChem (NCBI)