CAS 61871-83-8 is the registry number for 1-(2-Amino-3,5-dimethylphenyl)-2-chloroethanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-amino-3,5-dimethylphenyl)-2-chloroethanone (CAS 61871-83-8) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 1-(2-amino-3,5-dimethylphenyl)-2-chloroethanone. InChIKey: ZSGQNRUYHJMIBL-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 1-(2-amino-3,5-dimethylphenyl)-2-chloroethanone |
| InChIKey | ZSGQNRUYHJMIBL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(=O)CCl)N)C |
Computed by PubChem (NCBI)