CAS 61876-73-1 is the registry number for H-L-Arg-pna 2hbr, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(2S)-2-amino-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide;dihydrobromide (CAS 61876-73-1) is a chemical compound with the molecular formula C12H20Br2N6O3 and a molecular weight of 456.13 g/mol. IUPAC name: (2S)-2-amino-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide;dihydrobromide. InChIKey: JWRHZRASHMPFSP-XRIOVQLTSA-N.
| Molecular formula | C12H20Br2N6O3 |
|---|---|
| Molecular weight | 456.13 g/mol |
| IUPAC name | (2S)-2-amino-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide;dihydrobromide |
| InChIKey | JWRHZRASHMPFSP-XRIOVQLTSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)[C@H](CCCN=C(N)N)N)[N+](=O)[O-].Br.Br |
Computed by PubChem (NCBI)