CAS 61894-63-1 is the registry number for 3-Nitrophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 1g.
N-[4,5-dihydroxy-6-(hydroxymethyl)-2-(3-nitrophenoxy)oxan-3-yl]acetamide (CAS 61894-63-1) is a chemical compound with the molecular formula C14H18N2O8 and a molecular weight of 342.30 g/mol. IUPAC name: N-[4,5-dihydroxy-6-(hydroxymethyl)-2-(3-nitrophenoxy)oxan-3-yl]acetamide. InChIKey: GUGICLFTTIFEPS-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O8 |
|---|---|
| Molecular weight | 342.30 g/mol |
| IUPAC name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-(3-nitrophenoxy)oxan-3-yl]acetamide |
| InChIKey | GUGICLFTTIFEPS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1C(C(C(OC1OC2=CC=CC(=C2)[N+](=O)[O-])CO)O)O |
Computed by PubChem (NCBI)