Products 61899-39-6
CAS 61899-39-6 is the registry number for (R)-Bicyclo[4.2.0]octa-1,3,5-trien-7-amine hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(7R)-bicyclo[4.2.0]octa-1,3,5-trien-7-amine;hydrochloride (CAS 61899-39-6) is a chemical compound with the molecular formula C8H10ClN and a molecular weight of 155.62 g/mol. IUPAC name: (7R)-bicyclo[4.2.0]octa-1,3,5-trien-7-amine;hydrochloride. InChIKey: DMXZQYQZYGGJTC-DDWIOCJRSA-N.
| Molecular formula | C8H10ClN |
|---|---|
| Molecular weight | 155.62 g/mol |
| IUPAC name | (7R)-bicyclo[4.2.0]octa-1,3,5-trien-7-amine;hydrochloride |
| InChIKey | DMXZQYQZYGGJTC-DDWIOCJRSA-N |
| SMILES | C1[C@H](C2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)