CAS 619-72-7 appears in our catalog under these names: 4-Nitrobenzonitrile, 4–Nitrobenzonitrile, 4-Nitrobenzonitrile, >98.0%(GC), 4-Nitrobenzonitrile, 97%, 4-Nitrobenzonitrile 97%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 10g, 50g, 5g, 100g, 250g, 25g, 500g.
4-nitrobenzonitrile (CAS 619-72-7) is a chemical compound with the molecular formula C7H4N2O2 and a molecular weight of 148.12 g/mol. IUPAC name: 4-nitrobenzonitrile. InChIKey: NKJIFDNZPGLLSH-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2 |
|---|---|
| Molecular weight | 148.12 g/mol |
| IUPAC name | 4-nitrobenzonitrile |
| InChIKey | NKJIFDNZPGLLSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)